147005-91-2 Usage
Uses
Used in Pharmaceutical Research:
2-CHLOROMETHYL-3H-THIENO[3,2-D]PYRIMIDIN-4-ONE is used as a chemical intermediate for the synthesis of various pharmaceutical agents. Its unique structure and potential biological activity make it a promising candidate for the development of new drugs, particularly in the field of medicinal chemistry.
Used in Drug Discovery:
In the drug discovery process, 2-CHLOROMETHYL-3H-THIENO[3,2-D]PYRIMIDIN-4-ONE serves as a key component in the design and synthesis of novel therapeutic agents. Its chemical properties allow for further modification and optimization to enhance its pharmacological profile, making it a valuable asset in the search for new treatments for various diseases.
Used in Medicinal Chemistry:
2-CHLOROMETHYL-3H-THIENO[3,2-D]PYRIMIDIN-4-ONE is utilized in medicinal chemistry for the exploration of its potential interactions with biological targets. Its heterocyclic nature and functional groups provide opportunities for studying its binding affinity, selectivity, and mechanism of action, which are crucial for the development of effective drug candidates.
Note: Since the provided materials do not specify particular applications or industries for 2-CHLOROMETHYL-3H-THIENO[3,2-D]PYRIMIDIN-4-ONE, the uses listed above are general and based on the compound's potential in pharmaceutical research, drug discovery, and medicinal chemistry. If there are specific applications or industries mentioned in other materials, they should be included accordingly.
Check Digit Verification of cas no
The CAS Registry Mumber 147005-91-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,0,0 and 5 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 147005-91:
(8*1)+(7*4)+(6*7)+(5*0)+(4*0)+(3*5)+(2*9)+(1*1)=112
112 % 10 = 2
So 147005-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClN2OS/c8-3-5-9-4-1-2-12-6(4)7(11)10-5/h1-2H,3H2,(H,9,10,11)
