14712-23-3 Usage
Uses
Used in Pharmaceutical Industry:
1-[N-(2-HYDROXYETHYL)-4'-PIPERIDYL]-3-(4'-PIPERIDYL)PROPANE is used as a key intermediate in the synthesis of various pharmaceuticals due to its unique molecular structure and biological activities. Its potential applications include the development of new drugs with analgesic, antihistaminic, and anti-inflammatory properties, which can be beneficial in treating a wide range of medical conditions.
Used in Organic Chemistry Research:
1-[N-(2-HYDROXYETHYL)-4'-PIPERIDYL]-3-(4'-PIPERIDYL)PROPANE serves as a valuable compound in organic chemistry research, where it can be used to explore new synthetic pathways, investigate its reactivity with other molecules, and understand its potential applications in the creation of new organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 14712-23-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,7,1 and 2 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14712-23:
(7*1)+(6*4)+(5*7)+(4*1)+(3*2)+(2*2)+(1*3)=83
83 % 10 = 3
So 14712-23-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H30N2O/c18-13-12-17-10-6-15(7-11-17)3-1-2-14-4-8-16-9-5-14/h14-16,18H,1-13H2
