147300-08-1 Usage
General Description
1,2-Benzenediol,4,5-difluoro-(9CI), also known as 4,5-difluorocatechol, is a fluorinated derivative of catechol. This chemical compound is noted for its two fluorine atoms replacing the hydrogen atoms at the 4 and 5 positions of the phenolic hydroxyl groups of catechol. It's part of the halogenated catechols group and is used specifically in research for its unique properties. As with many halogenated compounds, it is crucial to handle it safely due to its potential reactivity. It may be used in the synthesis of other complex compounds in pharmaceutical and chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 147300-08-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,3,0 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 147300-08:
(8*1)+(7*4)+(6*7)+(5*3)+(4*0)+(3*0)+(2*0)+(1*8)=101
101 % 10 = 1
So 147300-08-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H4F2O2/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H
