147310-67-6 Usage
General Description
The chemicals "(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid, 2,3,4,5,6-pentahydroxyhexanoate, zinc(+2) cation" consist of a specific amino acid, a compound containing five hydroxyl (OH) groups, and a zinc cation with a positive charge of +2. The amino acid, (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid, is a derivative of lysine and is commonly found in proteins. The compound 2,3,4,5,6-pentahydroxyhexanoate contains five hydroxyl groups and a six-carbon chain. The zinc cation is an essential mineral that plays a role in various biological processes such as enzyme function, immune system function, and wound healing. These chemicals may have biological, nutritional, or industrial applications due to their unique properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 147310-67-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,3,1 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 147310-67:
(8*1)+(7*4)+(6*7)+(5*3)+(4*1)+(3*0)+(2*6)+(1*7)=116
116 % 10 = 6
So 147310-67-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H14N4O2.2C6H12O7.Zn/c7-4(5(11)12)2-1-3-10-6(8)9;2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2*2-5,7-11H,1H2,(H,12,13);/q;;;+2/p-2/t4-;;;/m0.../s1
