14742-39-3 Usage
General Description
2,3,5,6-Tetrafluorophenyloxy-acetic acid is a chemical compound with the molecular formula C8H5F4O3. It is a synthetic organic compound with the functional groups of both phenol and carboxylic acid. 2,3,5,6-TETRAFLUOROPHENYLOXY-ACETIC ACID is used in the production of pharmaceuticals and agrochemicals due to its ability to act as a building block for a variety of organic synthesis reactions. Additionally, it has potential applications in the field of materials science and surface chemistry due to its unique molecular structure and reactivity. As a result, 2,3,5,6-tetrafluorophenyloxy-acetic acid has potential uses in a wide range of industries and research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 14742-39-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,7,4 and 2 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 14742-39:
(7*1)+(6*4)+(5*7)+(4*4)+(3*2)+(2*3)+(1*9)=103
103 % 10 = 3
So 14742-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H4F4O3/c9-3-1-4(10)7(12)8(6(3)11)15-2-5(13)14/h1H,2H2,(H,13,14)/p-1
