14752-92-2 Usage
General Description
N-ACETYL-GLY-LYS METHYL ESTER ACETATE SALT is a chemical compound that is derived from the amino acid lysine. It is commonly used in biochemical and medical research as a precursor for the synthesis of peptides and proteins. N-ACETYL-GLY-LYS METHYL ESTER ACETATE SALT is also known for its potential therapeutic applications, including its role in enhancing wound healing and tissue repair. Additionally, N-ACETYL-GLY-LYS METHYL ESTER ACETATE SALT is used in the development of drug delivery systems and pharmaceutical formulations. Its acetate salt form increases its solubility and stability, making it more suitable for various experimental and pharmaceutical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 14752-92-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,7,5 and 2 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 14752-92:
(7*1)+(6*4)+(5*7)+(4*5)+(3*2)+(2*9)+(1*2)=112
112 % 10 = 2
So 14752-92-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H21N3O4/c1-8(15)14-7-10(16)13-6-4-3-5-9(12)11(17)18-2/h9H,3-7,12H2,1-2H3,(H,13,16)(H,14,15)