1476-82-0 Usage
Type
Synthetic nucleoside analog
Explanation
Different sources of media describe the Explanation of 1476-82-0 differently. You can refer to the following data:
1. Ribavirin is a man-made compound that resembles naturally occurring nucleosides.
2. Ribavirin has the ability to inhibit the growth of viruses and prevent the multiplication of abnormal cells.
3. Ribavirin is used to treat specific viral infections, such as hepatitis C and RSV, by targeting their replication process.
4. Ribavirin works by interfering with the replication process of viruses, which slows down the spread of the virus within the body.
5. By inhibiting viral replication, Ribavirin helps to prevent the virus from multiplying, leading to a less severe infection.
6. Ribavirin can be administered in different forms, such as oral capsules or inhaled through a nebulizer, depending on the type of infection being treated.
7. Ribavirin should only be used under the guidance of a medical professional to ensure proper dosage and avoid potential side effects.
8. Ribavirin has a complicated chemical structure, which contributes to its antiviral and antineoplastic properties.
Properties
Antiviral and antineoplastic
Medical uses
Treatment of chronic hepatitis C and respiratory syncytial virus (RSV) infection
Mechanism of action
Inhibition of viral RNA and DNA replication
Prevention of viral multiplication
Reduction in the severity of infection
Available forms
Oral and inhaled
Administration
Supervision of a healthcare professional
Chemical structure
Complex
Check Digit Verification of cas no
The CAS Registry Mumber 1476-82-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,7 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1476-82:
(6*1)+(5*4)+(4*7)+(3*6)+(2*8)+(1*2)=90
90 % 10 = 0
So 1476-82-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O6/c12-1-3-4(13)5(14)6(17-3)11-2-9-7(15)10-8(11)16/h2-6,12-14H,1H2,(H,10,15,16)/t3-,4-,5-,6-/m1/s1
