147687-06-7 Usage
General Description
(9H-Fluoren-9-yl)methyl methyl(2-oxoethyl)carbamate is a chemical compound with the molecular formula C20H19NO3. It is derived from fluorene and contains a carbamate functional group, which is commonly used in organic synthesis and medicinal chemistry. (9H-Fluoren-9-yl)methyl methyl(2-oxoethyl)carbamate may have potential applications in pharmaceuticals, agrochemicals, and materials science due to its unique chemical structure and properties. Further research and development may reveal its specific uses and potential impacts in various industrial and scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 147687-06-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,6,8 and 7 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 147687-06:
(8*1)+(7*4)+(6*7)+(5*6)+(4*8)+(3*7)+(2*0)+(1*6)=167
167 % 10 = 7
So 147687-06-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H17NO3/c1-19(10-11-20)18(21)22-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,11,17H,10,12H2,1H3
