147726-43-0 Usage
Description
(Z)-2,3-dihydro-2-[methoxy(methylthio)methylene]-1H-Inden-1-one is a chemical compound derived from indene, a bicyclic hydrocarbon. It features a unique structure with a methoxy(methylthio)methylene group attached to a dihydro-indenone ring system. (Z)-2,3-dihydro-2-[methoxy(methylthio)methylene]-1H-Inden-1-one has potential applications in organic synthesis and may exhibit various biological activities, making it a subject of interest for further research in the development of new materials and pharmaceuticals.
Uses
Used in Organic Synthesis:
(Z)-2,3-dihydro-2-[methoxy(methylthio)methylene]-1H-Inden-1-one is used as an intermediate in the synthesis of various organic compounds due to its unique structural features. Its ability to undergo further chemical reactions allows for the creation of a wide range of products.
Used in Pharmaceutical Development:
(Z)-2,3-dihydro-2-[methoxy(methylthio)methylene]-1H-Inden-1-one is used as a starting material for the development of new pharmaceuticals. Its structural characteristics may contribute to the discovery of novel drugs with potential biological activities.
Used in Material Science:
(Z)-2,3-dihydro-2-[methoxy(methylthio)methylene]-1H-Inden-1-one is used as a component in the research and development of new materials. Its unique structure may provide properties that are beneficial for specific applications in material science.
Check Digit Verification of cas no
The CAS Registry Mumber 147726-43-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,7,2 and 6 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 147726-43:
(8*1)+(7*4)+(6*7)+(5*7)+(4*2)+(3*6)+(2*4)+(1*3)=150
150 % 10 = 0
So 147726-43-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H12O2S/c1-14-12(15-2)10-7-8-5-3-4-6-9(8)11(10)13/h3-6H,7H2,1-2H3/b12-10-
