147745-20-8 Usage
Uses
Since the provided materials do not explicitly mention specific uses or applications for Methyl-2-amino-3-cyclohexyl-3-oxo-propionate hydrochloride in industry, pharmaceuticals, or research, it is possible that Methyl-2-amino-3-cyclohexyl-3-oxo-propionate hydrochloride is either novel or not widely used. However, given its chemical structure, it may have potential applications in various fields once its properties and interactions are further studied and understood. Potential uses could include, but are not limited to:
Used in Pharmaceutical Industry:
Methyl-2-amino-3-cyclohexyl-3-oxo-propionate hydrochloride could be used as a pharmaceutical intermediate for the synthesis of drugs targeting specific biological pathways or receptors, given its complex structure and functional groups.
Used in Chemical Research:
Methyl-2-amino-3-cyclohexyl-3-oxo-propionate hydrochloride might serve as a research tool in the study of chemical reactions, mechanisms, or as a model for understanding the behavior of similar compounds with cyclohexyl groups and related functional groups.
Used in Material Science:
Methyl-2-amino-3-cyclohexyl-3-oxo-propionate hydrochloride's unique structure could potentially be explored for its properties in material science, such as its potential use in the development of new materials with specific characteristics, like improved strength or chemical stability.
Check Digit Verification of cas no
The CAS Registry Mumber 147745-20-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,7,4 and 5 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 147745-20:
(8*1)+(7*4)+(6*7)+(5*7)+(4*4)+(3*5)+(2*2)+(1*0)=148
148 % 10 = 8
So 147745-20-8 is a valid CAS Registry Number.
InChI:InChI=1S/C10H17NO3.ClH/c1-14-10(13)8(11)9(12)7-5-3-2-4-6-7;/h7-8H,2-6,11H2,1H3;1H
