147937-33-5 Usage
Description
2-(CHLOROMETHYL)-6-PHENYLPYRIDINE, with the molecular formula C12H10ClN, is a substituted pyridine derivative characterized by a chloromethyl group attached to the second carbon of the pyridine ring and a phenyl group attached to the sixth carbon. This chemical compound is known for its potential applications in various fields, including pharmaceuticals, agrochemicals, and organic synthesis.
Uses
Used in Pharmaceutical Industry:
2-(CHLOROMETHYL)-6-PHENYLPYRIDINE is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the formation of complex molecular structures. Its presence in the synthesis process can lead to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-(CHLOROMETHYL)-6-PHENYLPYRIDINE is employed as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its role in these compounds can enhance their effectiveness in controlling pests and weeds, thereby improving agricultural productivity.
Used in Organic Synthesis:
2-(CHLOROMETHYL)-6-PHENYLPYRIDINE is used as a building block in organic synthesis, allowing for the preparation of various heterocyclic compounds. These compounds can be further utilized in the development of new chemical entities with potential applications in different industries.
Used in Biological and Pharmacological Research:
2-(CHLOROMETHYL)-6-PHENYLPYRIDINE has been studied for its potential biological and pharmacological activities, including its possible use as an anti-cancer agent. Its unique structure may contribute to the development of novel therapeutic strategies for the treatment of cancer and other diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 147937-33-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,9,3 and 7 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 147937-33:
(8*1)+(7*4)+(6*7)+(5*9)+(4*3)+(3*7)+(2*3)+(1*3)=165
165 % 10 = 5
So 147937-33-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H10ClN/c13-9-11-7-4-8-12(14-11)10-5-2-1-3-6-10/h1-8H,9H2
147937-33-5Relevant articles and documents
URIDINE NUCLEOSIDE DERIVATIVES, COMPOSITIONS AND METHODS OF USE
-
Paragraph 0192; 0199, (2018/04/20)
This disclosure relates to uridine nucleoside derivatives, compositions comprising therapeutically effective amounts of those nucleoside derivatives and methods of using those nucleoside derivatives or compositions in treating disorders that are responsive to compounds, such as agonists, of P2Y6 receptor, e.g., neuronal disorders, including neurodegenerative disorders (e.g., Alzheimer's disease, Parkinson's disease) and traumatic CNS injury, pain, Down Syndrome (DS), glaucoma and inflammatory conditions.
