148-64-1 Usage
Uses
Used in Pharmaceutical Industry:
N-[(5-chloro-2-thienyl)methyl]-N',N'-dimethyl-N-2-pyridylethylenediamine 2-hydroxy-1,2,3-propanetricarboxylate is used as a pharmaceutical compound for its potential to interact with biological systems. Its complex structure may allow it to target specific receptors or enzymes, making it a candidate for the development of new drugs or therapies.
Used in Agricultural Industry:
In agriculture, N-[(5-chloro-2-thienyl)methyl]-N',N'-dimethyl-N-2-pyridylethylenediamine 2-hydroxy-1,2,3-propanetricarboxylate may be utilized as a component in the development of pesticides or fertilizers. Its ability to form complex interactions could be leveraged to enhance crop protection or nutrient delivery to plants.
Used in Chemical Research:
N-[(5-chloro-2-thienyl)methyl]-N',N'-dimethyl-N-2-pyridylethylenediamine 2-hydroxy-1,2,3-propanetricarboxylate is also used in chemical research as a model for studying the interactions between complex organic molecules and biological systems. Understanding these interactions can provide insights into the development of new materials and the fundamental principles of chemical biology.
Further research and analysis are necessary to fully understand the properties and potential uses of N-[(5-chloro-2-thienyl)methyl]-N',N'-dimethyl-N-2-pyridylethylenediamine 2-hydroxy-1,2,3-propanetricarboxylate, as its diverse chemical structure suggests a wide range of possible applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 148-64-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,4 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 148-64:
(5*1)+(4*4)+(3*8)+(2*6)+(1*4)=61
61 % 10 = 1
So 148-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H18ClN3S.C6H8O7/c1-17(2)9-10-18(14-5-3-4-8-16-14)11-12-6-7-13(15)19-12;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-8H,9-11H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)
