148050-69-5 Usage
General Description
"1H-Indene-4-carboxylicacid,2,3-dihydro-6,7-dihydroxy-1-oxo-(9CI)" is a complex chemical compound which is characterized by various functional groups such as an indene group, a carboxylic acid group and hydroxy groups. Though information on this specific chemical is limited, these functional groups suggest a range of potential reactions and interactions. Its indene component, a hydrocarbon found in coal tar, has aromatic properties, while the presence of carboxylic acid and hydroxy groups -OH and -COOH respectively, make it polar and capable of forming hydrogen bonds. The cited chemical's 1-oxo property also indicates it contains a carbonyl group C=O, commonly found in ketones and aldehydes. However, without specific studies or use-cases, it's hard to determine the exact properties and potential applications of this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 148050-69-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,0,5 and 0 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 148050-69:
(8*1)+(7*4)+(6*8)+(5*0)+(4*5)+(3*0)+(2*6)+(1*9)=125
125 % 10 = 5
So 148050-69-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H8O5/c11-6-2-1-4-5(10(14)15)3-7(12)9(13)8(4)6/h3,12-13H,1-2H2,(H,14,15)
