148050-69-5 Usage
Description
1H-Indene-4-carboxylicacid,2,3-dihydro-6,7-dihydroxy-1-oxo-(9CI) is a complex chemical compound characterized by various functional groups such as an indene group, a carboxylic acid group, and hydroxy groups. Its indene component, a hydrocarbon found in coal tar, has aromatic properties, while the presence of carboxylic acid and hydroxy groups -OH and -COOH respectively, make it polar and capable of forming hydrogen bonds. The 1-oxo property indicates it contains a carbonyl group C=O, commonly found in ketones and aldehydes. Although specific studies or use-cases are limited, these functional groups suggest a range of potential reactions and interactions.
Uses
Used in Chemical Synthesis:
1H-Indene-4-carboxylicacid,2,3-dihydro-6,7-dihydroxy-1-oxo-(9CI) is used as a building block for the synthesis of more complex molecules due to its diverse functional groups, which allow for various chemical reactions and interactions.
Used in Pharmaceutical Research:
1H-Indene-4-carboxylicacid,2,3-dihydro-6,7-dihydroxy-1-oxo-(9CI) is used as a potential candidate in pharmaceutical research for the development of new drugs, given its polar nature and ability to form hydrogen bonds, which are essential for molecular recognition and binding.
Used in Material Science:
1H-Indene-4-carboxylicacid,2,3-dihydro-6,7-dihydroxy-1-oxo-(9CI) is used in material science for the development of new materials with specific properties, such as improved stability or reactivity, due to its aromatic and polar characteristics.
Used in Analytical Chemistry:
1H-Indene-4-carboxylicacid,2,3-dihydro-6,7-dihydroxy-1-oxo-(9CI) is used as a reference compound or a standard in analytical chemistry for the identification and quantification of similar compounds, taking advantage of its unique functional groups and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 148050-69-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,0,5 and 0 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 148050-69:
(8*1)+(7*4)+(6*8)+(5*0)+(4*5)+(3*0)+(2*6)+(1*9)=125
125 % 10 = 5
So 148050-69-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H8O5/c11-6-2-1-4-5(10(14)15)3-7(12)9(13)8(4)6/h3,12-13H,1-2H2,(H,14,15)
