14807-26-2 Usage
Uses
Used in Fragrance and Flavoring Industry:
Hydrocinnamaldehyde, o-(hydroxymethyl)(8CI) is used as a key ingredient in the creation of fragrances and flavorings due to its distinctive sweet, floral, and spicy scent. It contributes to the development of various perfumes, colognes, and food products, enhancing their sensory appeal.
Used in Pharmaceutical Synthesis:
Hydrocinnamaldehyde, o-(hydroxymethyl)(8CI) is also utilized in the synthesis of pharmaceuticals, where its unique chemical structure allows for the development of new drugs with potential therapeutic applications. Its versatility in chemical reactions makes it a valuable intermediate in medicinal chemistry.
Used in Organic Chemistry and Chemical Research:
Hydrocinnamaldehyde, o-(hydroxymethyl)(8CI) has potential applications in the field of organic chemistry, where it can be employed in various chemical reactions to produce a range of organic compounds. Its presence in chemical research aids in the exploration of new reaction pathways and the discovery of novel compounds with diverse applications.
However, it is important to exercise caution when handling Hydrocinnamaldehyde, o-(hydroxymethyl)(8CI), as it may pose hazards if not used properly. Proper safety measures and handling protocols should be followed to ensure the safe utilization of Hydrocinnamaldehyde, o-(hydroxymethyl)- (8CI) in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 14807-26-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,8,0 and 7 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 14807-26:
(7*1)+(6*4)+(5*8)+(4*0)+(3*7)+(2*2)+(1*6)=102
102 % 10 = 2
So 14807-26-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12O2/c11-7-3-6-9-4-1-2-5-10(9)8-12/h1-2,4-5,7,12H,3,6,8H2
