148235-02-3 Usage
General Description
The chemical compound (3-methoxy-benzyl)-(4-methoxy-benzyl)-amine is a derivative of benzylamine, containing two methoxy groups attached to the benzene rings. It is commonly used in organic synthesis and medicinal chemistry as a building block for the preparation of various pharmaceuticals and biologically active compounds. The presence of methoxy groups on the benzene rings can affect the compound's reactivity and biological properties, making it a valuable intermediate for the synthesis of diverse molecules with potential pharmacological activities. Additionally, the compound's structure and properties make it suitable for use in the development of new drug candidates and other biologically relevant molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 148235-02-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,2,3 and 5 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 148235-02:
(8*1)+(7*4)+(6*8)+(5*2)+(4*3)+(3*5)+(2*0)+(1*2)=123
123 % 10 = 3
So 148235-02-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H19NO2/c1-18-15-8-6-13(7-9-15)11-17-12-14-4-3-5-16(10-14)19-2/h3-10,17H,11-12H2,1-2H3
148235-02-3Relevant articles and documents
PHELLODENDRINE ANALOGS AND ALLERGY TYPE IV SUPPRESSOR CONTAINING THE SAME AS ACTIVE INGREDIENT
-
, (2008/06/13)
Phellodendrine analogs represented by general formula (I), wherein A represents the group (a); B represents hydrogen, lower alkyl or lower acyl, or alternatively A and B together with the adjacent nitrogen atom form a substituted 1,2,3,4-tetrahydroisoquinoline ring represented by general formula (II), R11, R12, R21, R22, R31 and R32 represent each hydrogen, hydroxyl or lower alkoxy; n1 represents a number of 0 to 2; n2 represents a number of 1 and 2; and m1 represents a number of 0 to 1, provided tsat when A represents the group (b), and n2 is 2, B is lower acyl, and that when A and B together form a substituted 1,2,3,4-tetrahydroisoquinoline ring, n1 is 1 and m1 is not 0. These analogs (I) and related compounds have an excellent activity of suppressing allergy type IV and hence are utilizable as a medicine efficacious against diseases wherein allergy type IV participates, such as chronic hepatitis, intractable asthma, nephrotic syndrome or rheumatism.