148639-07-0 Usage
General Description
2-Chloro-3-Fluoro-4-Iodopyridine is a specialized chemical compound that's adorned with various distinct elements such as chloro, fluoro, and iodopyridine. This can be used in a wide variety of chemical reactions and studies due to its unique structure and reactive properties. It is commonly used in synthetic chemistry, often as an intermediate compound in the synthesis of more complex molecules. Due to its combined presence of halogens and pyridine, it possesses varying reactivity which makes it an essential chemical substance in numerous sectors like pharmaceuticals or materials science. However, due to its reactivity, it should be cautiously handled and appropriately stored.
Check Digit Verification of cas no
The CAS Registry Mumber 148639-07-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,6,3 and 9 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 148639-07:
(8*1)+(7*4)+(6*8)+(5*6)+(4*3)+(3*9)+(2*0)+(1*7)=160
160 % 10 = 0
So 148639-07-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H2ClFIN/c6-5-4(7)3(8)1-2-9-5/h1-2H
