148716-35-2 Usage
Description
1-[4-(2-AMINOETHYL)PIPERAZIN-1-YL]ETHANONE is a chemical compound characterized by a piperazine ring with an aminoethyl side chain and an ethanone group. It serves as a versatile intermediate in the synthesis of pharmaceuticals and organic compounds, playing a significant role in medicinal chemistry as a building block for drug discovery and development. Due to its potential hazardous properties, it is crucial to handle and store this chemical with care, ensuring its use only under proper laboratory conditions.
Uses
Used in Pharmaceutical Industry:
1-[4-(2-AMINOETHYL)PIPERAZIN-1-YL]ETHANONE is used as a chemical intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure allows for the creation of diverse compounds with potential medicinal properties.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 1-[4-(2-AMINOETHYL)PIPERAZIN-1-YL]ETHANONE is utilized as a key component in the synthesis of a wide range of organic compounds. Its presence in these compounds can influence their chemical and physical properties, making it a valuable asset in the development of new materials and substances.
Used in Drug Discovery and Development:
As a building block in medicinal chemistry, 1-[4-(2-AMINOETHYL)PIPERAZIN-1-YL]ETHANONE is employed in drug discovery and development processes. Its incorporation into various molecular structures can lead to the identification of novel drug candidates with potential therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 148716-35-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,7,1 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 148716-35:
(8*1)+(7*4)+(6*8)+(5*7)+(4*1)+(3*6)+(2*3)+(1*5)=152
152 % 10 = 2
So 148716-35-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H17N3O/c1-8(12)11-6-4-10(3-2-9)5-7-11/h2-7,9H2,1H3
