1488-48-8 Usage
Uses
Used in Pharmaceutical Industry:
4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its ability to inhibit the activity of certain enzymes makes it a valuable component in the development of new drugs.
Used in Drug Design and Discovery:
As a building block in drug design, 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid is employed for its potential to form a wide range of chemical structures. Its reactivity in amination and carboxylation reactions enables the creation of diverse molecules with potential therapeutic applications.
Used in Chemical Research:
4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid serves as a subject of study in chemical research, where its properties and reactivity are explored to understand its potential applications and interactions with other compounds. This research can lead to the discovery of new uses and applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 1488-48-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,8 and 8 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1488-48:
(6*1)+(5*4)+(4*8)+(3*8)+(2*4)+(1*8)=98
98 % 10 = 8
So 1488-48-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N4O2/c8-5-4-3(7(12)13)1-9-6(4)11-2-10-5/h1-2H,(H,12,13)(H3,8,9,10,11)
