148832-07-9 Usage
Chemical structure
A complex chemical compound composed of two units of 3-deoxyglucopyranose linked to a propyl group and a benzoylbenzoate group.
3-deoxyglucopyranose units
Sugar-derived molecules commonly found in carbohydrates.
Propyl group
An organic compound derived from propane.
Benzoylbenzoate group
An organic compound derived from benzoic acid.
Unique combination
A combination of carbohydrate and organic molecules.
Pharmaceuticals
May have potential uses in the development of new drugs or drug delivery systems.
Materials science
Could be used in the development of new materials with specific properties.
Agrochemicals
May have potential applications in the development of new pesticides or fertilizers.
Further research needed
To understand its specific properties and potential uses.
Molecular weight
Approximately 534.59 g/mol (calculated from the molecular formula).
Functional groups
The compound contains several functional groups, including hydroxyl (-OH) groups from the 3-deoxyglucopyranose units, an ester group (-COO-) from the benzoylbenzoate group, and an alkyl group (propyl) attached to the benzene ring.
Solubility
The solubility of this compound is not explicitly mentioned in the provided material, but it can be inferred that it may be soluble in organic solvents such as ethanol, methanol, or acetone, due to the presence of the organic components in its structure.
Stability
The stability of the compound is not mentioned in the material, but it can be assumed that it may be sensitive to hydrolysis or other chemical reactions due to the presence of the ester and hydroxyl functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 148832-07-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,8,3 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 148832-07:
(8*1)+(7*4)+(6*8)+(5*8)+(4*3)+(3*2)+(2*0)+(1*7)=149
149 % 10 = 9
So 148832-07-9 is a valid CAS Registry Number.
InChI:InChI=1/C29H36O15/c30-10-20(34)25(39)27(22(36)12-32)42-14-19(15-43-28(23(37)13-33)26(40)21(35)11-31)44-29(41)18-8-6-17(7-9-18)24(38)16-4-2-1-3-5-16/h1-9,12-13,19-23,25-28,30-31,34-37,39-40H,10-11,14-15H2/t20-,21-,22+,23+,25-,26-,27-,28-/m1/s1