148883-56-1 Usage
Description
BENZYL-THIOPHEN-2-YLMETHYL-AMINE, also known as Benzyl(thiophen-2-ylmethyl)amine (CAS# 73325-61-8), is an organic compound with a unique chemical structure that features a benzyl group attached to a thiophene ring with a methylene amine functional group. BENZYL-THIOPHEN-2-YLMETHYL-AMINE is known for its potential applications in the synthesis of various heterocyclic compounds, particularly those with β-chloroethylamines containing heterocyclic nuclei.
Uses
Used in Pharmaceutical Industry:
BENZYL-THIOPHEN-2-YLMETHYL-AMINE is used as a synthetic intermediate for the preparation of β-chloroethylamines containing heterocyclic nuclei. These heterocyclic compounds are essential in the development of new pharmaceuticals, particularly those with potential therapeutic applications in various medical conditions.
Used in Chemical Research:
In the field of chemical research, BENZYL-THIOPHEN-2-YLMETHYL-AMINE serves as a valuable compound for studying the properties and reactivity of heterocyclic systems. Its unique structure allows researchers to explore new reaction pathways and develop innovative synthetic methods for the preparation of complex organic molecules.
Used in Material Science:
The potential applications of BENZYL-THIOPHEN-2-YLMETHYL-AMINE extend to the field of material science, where its heterocyclic structure can be utilized in the development of novel materials with specific properties. These materials could find use in various industries, such as electronics, aerospace, and automotive, where high-performance materials are in demand.
Check Digit Verification of cas no
The CAS Registry Mumber 148883-56-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,8,8 and 3 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 148883-56:
(8*1)+(7*4)+(6*8)+(5*8)+(4*8)+(3*3)+(2*5)+(1*6)=181
181 % 10 = 1
So 148883-56-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NS/c1-2-5-11(6-3-1)9-13-10-12-7-4-8-14-12/h1-8,13H,9-10H2
