148901-52-4 Usage
Uses
Since the provided materials do not explicitly mention the uses of 2-FLUORO-6-[4-(METHYLTHIO)PHENOXY]BENZONITRILE, it is not possible to list its applications based on the given information. However, benzonitriles in general may have potential applications in various industries, such as pharmaceuticals, materials science, or chemical research, depending on their specific properties and characteristics. Further studies and assays would be necessary to determine the exact uses and applications of 2-FLUORO-6-[4-(METHYLTHIO)PHENOXY]BENZONITRILE.
Check Digit Verification of cas no
The CAS Registry Mumber 148901-52-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,9,0 and 1 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 148901-52:
(8*1)+(7*4)+(6*8)+(5*9)+(4*0)+(3*1)+(2*5)+(1*2)=144
144 % 10 = 4
So 148901-52-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H10FNOS/c1-18-11-7-5-10(6-8-11)17-14-4-2-3-13(15)12(14)9-16/h2-8H,1H3
Xn:Harmful;
