148940-94-7 Usage
Uses
Used in Pharmaceutical Industry:
6-FLUORO-INDAN-1-YLAMINE HYDROCHLORIDE is used as a reagent for the synthesis of various pharmaceuticals and organic compounds. Its unique structure and properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Organic Chemistry:
6-FLUORO-INDAN-1-YLAMINE HYDROCHLORIDE is used as a reagent in organic chemistry for the synthesis of various organic compounds. Its fluorine atom and indane ring structure provide unique chemical properties that can be exploited in the formation of new molecules and materials.
It is important to handle 6-FLUORO-INDAN-1-YLAMINE HYDROCHLORIDE with care, as it can be hazardous when inhaled, ingested, or comes in contact with the skin and eyes. Proper safety measures should be taken during its use to minimize potential risks.
Check Digit Verification of cas no
The CAS Registry Mumber 148940-94-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,9,4 and 0 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 148940-94:
(8*1)+(7*4)+(6*8)+(5*9)+(4*4)+(3*0)+(2*9)+(1*4)=167
167 % 10 = 7
So 148940-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H10FN.ClH/c10-7-3-1-6-2-4-9(11)8(6)5-7;/h1,3,5,9H,2,4,11H2;1H
