148960-34-3 Usage
General Description
4-FLUORO-INDAN-1-YLAMINE HYDROCHLORIDE is a chemical compound with the molecular formula C10H12FN?HCl. It is a hydrochloride salt form of 4-Fluoroindan-1-ylamine, a derivative of indane and an amine. 4-FLUORO-INDAN-1-YLAMINE HYDROCHLORIDE is used in the synthesis of pharmaceuticals and other organic compounds, particularly in the development of new drugs and research chemicals. It is known for its potential as a building block in organic synthesis, and its hydrochloride form provides increased stability and solubility for various applications. Additionally, it may also have potential uses in medicinal chemistry and drug discovery due to its unique structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 148960-34-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,9,6 and 0 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 148960-34:
(8*1)+(7*4)+(6*8)+(5*9)+(4*6)+(3*0)+(2*3)+(1*4)=163
163 % 10 = 3
So 148960-34-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H7FO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5H2
148960-34-3Relevant articles and documents
NOVEL COMPOUNDS
-
Page/Page column 56, (2022/03/22)
The invention relates to compounds of formula (I) and related aspects.
THERAPEUTIC FLUOROETHYLCYANO GUANIDINES
-
Page/Page column 14, (2008/12/04)
Disclosed herein is compound having a formula as described herein. Therapeutic methods, compositions, and medicaments related thereto are also disclosed.
