149300-54-9 Usage
General Description
10-METHYL-9-(PHENOXYCARBONYL)ACRIDINIUM FLUOROSULFONATE is a chemical compound with a complex structure consisting of a acridine core with a phenoxycarbonyl substituent and a fluorosulfonate group. 10-METHYL-9-(PHENOXYCARBONYL)ACRIDINIUM FLUOROSULFONATE is often used as a fluorescent dye, particularly in DNA sequencing and other molecular biology applications. Its fluorescent properties make it useful for labeling and visualization of nucleic acids and proteins in various biological studies. Additionally, 10-METHYL-9-(PHENOXYCARBONYL)ACRIDINIUM FLUOROSULFONATE has been investigated for its potential use in medical diagnostics and forensic science due to its sensitive and stable fluorescence. However, it should be handled with caution due to its potential for toxicity and environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 149300-54-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,3,0 and 0 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 149300-54:
(8*1)+(7*4)+(6*9)+(5*3)+(4*0)+(3*0)+(2*5)+(1*4)=119
119 % 10 = 9
So 149300-54-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H16NO2.FHO3S/c1-22-18-13-7-5-11-16(18)20(17-12-6-8-14-19(17)22)21(23)24-15-9-3-2-4-10-15;1-5(2,3)4/h2-14H,1H3;(H,2,3,4)/q+1;/p-1