14932-25-3 Usage
General Description
(CIS)-2-AMINO-3-CARBOXYBICYCLO[2.2.1]HEPTANE HYDROCHLORIDE is a chemical compound that is commonly used as a pharmaceutical intermediate. It is a bicyclic compound containing an amino and carboxylic acid group. (CIS)-2-AMINO-3-CARBOXYBICYCLO[2.2.1]HEPTANE HYDROCHLORIDE has a unique molecular structure due to its bicyclic framework, and its hydrochloride salt form makes it more suitable for pharmaceutical applications. It may be used in the synthesis of various pharmaceutical drugs or in biochemical research as a building block for more complex compounds. Its specific properties and potential uses in drug development make it a valuable compound in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 14932-25-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,9,3 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 14932-25:
(7*1)+(6*4)+(5*9)+(4*3)+(3*2)+(2*2)+(1*5)=103
103 % 10 = 3
So 14932-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO2.ClH/c9-7-5-2-1-4(3-5)6(7)8(10)11;/h4-7H,1-3,9H2,(H,10,11);1H/t4-,5+,6+,7-;/m0./s1