14939-93-6 Usage
General Description
4-(2,3-Dihydro-1,4-benzodioxin-6-yl)butanoic acid is a chemical compound with the molecular formula C14H16O5. It is a carboxylic acid derivative that contains a benzodioxin ring system. The compound has potential applications in medicinal chemistry and pharmacology due to its ability to bind to specific receptors in the human body. The benzodioxin ring structure is known to exhibit various biological activities, and research suggests that this compound may have potential as a therapeutic agent for certain medical conditions. Further studies are needed to explore the full range of potential uses for 4-(2,3-dihydro-1,4-benzodioxin-6-yl)butanoic acid and to understand its mechanism of action in the human body.
Check Digit Verification of cas no
The CAS Registry Mumber 14939-93-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,9,3 and 9 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14939-93:
(7*1)+(6*4)+(5*9)+(4*3)+(3*9)+(2*9)+(1*3)=136
136 % 10 = 6
So 14939-93-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H14O4/c13-12(14)3-1-2-9-4-5-10-11(8-9)16-7-6-15-10/h4-5,8H,1-3,6-7H2,(H,13,14)
