149488-98-2 Usage
Uses
Used in Pharmaceutical Industry:
2,3,4-Trifluoro benzeneethanamide is used as an intermediate for the production of pharmaceuticals, serving as a key component in the synthesis of a range of biologically active compounds. Its role in drug development is crucial, as it can contribute to the creation of new medications with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3,4-Trifluoro benzeneethanamide is employed as an intermediate in the synthesis of agrochemicals, which are essential for the development of pesticides, herbicides, and other crop protection products. Its presence in these compounds can enhance their effectiveness and selectivity, leading to improved agricultural outcomes.
Used in Specialty Chemicals Production:
2,3,4-Trifluoro benzeneethanamide is also used as an intermediate in the production of specialty chemicals, which are tailored for specific applications in various industries. Its versatility allows it to be incorporated into a wide array of chemical products, contributing to their unique properties and performance.
Used in Organic Synthesis:
As a reagent in organic synthesis, 2,3,4-Trifluoro benzeneethanamide is utilized for the modification of other chemical structures. Its presence can alter the reactivity and properties of compounds, making it a valuable tool in the synthesis of new and complex molecules for research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 149488-98-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,4,8 and 8 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 149488-98:
(8*1)+(7*4)+(6*9)+(5*4)+(4*8)+(3*8)+(2*9)+(1*8)=192
192 % 10 = 2
So 149488-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H8F3N/c9-6-2-1-5(3-4-12)7(10)8(6)11/h1-2H,3-4,12H2
