149605-62-9 Usage
Uses
Used in Pharmaceutical Industry:
2-(4-Methylpyridin-2-yl)acetic acid is used as an intermediate compound for the synthesis of various pharmaceuticals due to its unique chemical structure and potential therapeutic properties. It is being researched for its possible use in the treatment of different medical conditions, making it a valuable component in drug development.
Used in Chemical Industry:
In the chemical industry, 2-(4-Methylpyridin-2-yl)acetic acid is utilized as a key intermediate in the production of various organic compounds. Its versatility in chemical reactions and ability to form derivatives contribute to its significance in the synthesis of a range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 149605-62-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,6,0 and 5 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 149605-62:
(8*1)+(7*4)+(6*9)+(5*6)+(4*0)+(3*5)+(2*6)+(1*2)=149
149 % 10 = 9
So 149605-62-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2/c1-6-2-3-9-7(4-6)5-8(10)11/h2-4H,5H2,1H3,(H,10,11)
149605-62-9Relevant academic research and scientific papers
4-Aminopiperidine derivatives
-
Page/Page column 16, (2010/11/08)
The present invention relates to compounds of the formula (I) wherein R1 and R2 are as defined in the description and claims, and pharmaceutically acceptable salts thereof. The compounds are useful for the treatment and/or prophylaxis of diseases which are associated with DPP-IV, such as diabetes, non-insulin dependent diabetes mellitus and/or impaired glucose tolerance, obesity, and/or metabolic syndrome or β-cell protection.
