149609-86-9 Usage
Description
4-[(4-Chlorophenyl)thio]thiophene-3-carboxylic acid is a heterocyclic chemical compound with the molecular formula C14H9ClO2S2. It features a five-membered thiophene ring with four carbon atoms and one sulfur atom, a carboxylic acid group, a thioether group, and a chlorine-substituted phenyl ring. 4-[(4-CHLOROPHENYL)THIO]THIOPHENE-3-CARBOXYLIC ACID belongs to the class of thiophenes and exhibits unique chemical properties, including anti-inflammatory and antimicrobial activities. Its potential applications span across pharmaceuticals, agrochemicals, and materials science, making it a promising candidate for the development of new drugs and a valuable building block for synthesizing diverse organic compounds.
Uses
Used in Pharmaceutical Industry:
4-[(4-Chlorophenyl)thio]thiophene-3-carboxylic acid is used as a pharmaceutical intermediate for the development of new drugs. Its anti-inflammatory and antimicrobial properties make it a potential candidate for treating various inflammatory and infectious diseases. 4-[(4-CHLOROPHENYL)THIO]THIOPHENE-3-CARBOXYLIC ACID's unique chemical structure also allows for further modification and optimization to enhance its therapeutic effects and reduce potential side effects.
Used in Agrochemical Industry:
In the agrochemical industry, 4-[(4-Chlorophenyl)thio]thiophene-3-carboxylic acid is used as an active ingredient in the development of pesticides and fungicides. Its antimicrobial activity can help protect crops from various pathogens, thereby increasing crop yield and quality. Additionally, its potential use in the development of herbicides can help control unwanted plant growth in agricultural fields.
Used in Materials Science:
4-[(4-Chlorophenyl)thio]thiophene-3-carboxylic acid is used as a building block in materials science for the synthesis of diverse organic compounds. Its heterocyclic structure can be incorporated into various polymers, dyes, and other materials, potentially enhancing their properties and expanding their applications. For instance, it can be used in the development of conductive polymers for use in electronic devices or in the synthesis of novel dyes for colorants and pigments.
Check Digit Verification of cas no
The CAS Registry Mumber 149609-86-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,6,0 and 9 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 149609-86:
(8*1)+(7*4)+(6*9)+(5*6)+(4*0)+(3*9)+(2*8)+(1*6)=169
169 % 10 = 9
So 149609-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H7ClO2S2/c12-7-1-3-8(4-2-7)16-10-6-15-5-9(10)11(13)14/h1-6H,(H,13,14)
