149716-73-4 Usage
Uses
Used in Chemical Synthesis:
(S)-BoroPro-(-)-Pinanediol-HCl is used as a key intermediate in the synthesis of prolineboronate esters for various chemical applications. Its unique structure allows for the creation of new compounds with potential uses in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (S)-BoroPro-(-)-Pinanediol-HCl is used as a building block for the development of new drugs. Its chemical properties make it a valuable component in the design and synthesis of novel therapeutic agents.
Used in Research and Development:
(S)-BoroPro-(-)-Pinanediol-HCl is also utilized in research and development settings, where it serves as a valuable tool for studying the properties and behavior of prolineboronate esters. This knowledge can be applied to the development of new materials and technologies.
Used in Material Science:
In the field of material science, (S)-BoroPro-(-)-Pinanediol-HCl can be used to develop new materials with specific properties. Its unique chemical structure allows for the creation of materials with potential applications in various industries, such as electronics, aerospace, and automotive.
Check Digit Verification of cas no
The CAS Registry Mumber 149716-73-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,7,1 and 6 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 149716-73:
(8*1)+(7*4)+(6*9)+(5*7)+(4*1)+(3*6)+(2*7)+(1*3)=164
164 % 10 = 4
So 149716-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H24BNO2.ClH/c1-13(2)9-7-10(13)14(3)11(8-9)17-15(18-14)12-5-4-6-16-12;/h9-12,16H,4-8H2,1-3H3;1H/t9-,10-,11+,12-,14-;/m1./s1
