149986-58-3 Usage
General Description
4-[(3-Methoxyphenyl)methyl]-piperidine hydrochloride is a chemical compound that belongs to the class of piperidines. It is a hydrochloride salt of a piperidine derivative containing a methoxyphenylmethyl group. 4-[(3-METHOXYPHENYL)METHYL]-PIPERIDINE HYDROCHLORIDE may have potential applications in medicinal chemistry and pharmaceutical research due to its the piperidine core, which is a common structural motif in many bioactive compounds. Additionally, the presence of the methoxyphenylmethyl group may confer specific biological activities or properties to the compound, making it of interest for further study and investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 149986-58-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,9,8 and 6 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 149986-58:
(8*1)+(7*4)+(6*9)+(5*9)+(4*8)+(3*6)+(2*5)+(1*8)=203
203 % 10 = 3
So 149986-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO.ClH/c1-15-13-4-2-3-12(10-13)9-11-5-7-14-8-6-11;/h2-4,10-11,14H,5-9H2,1H3;1H
