149997-66-0 Usage
Chemical compound
3-(4-carboxamidophenyldithio)propionthioimidate
Derivative of
propionthioimidate
Contains
phenyldithio group and carboxamide group
Potential uses
chemical research, synthesis of organic and inorganic compounds, medicinal chemistry, pharmaceutical research
Ongoing study and exploration in scientific community to determine specific properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 149997-66-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,9,9 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 149997-66:
(8*1)+(7*4)+(6*9)+(5*9)+(4*9)+(3*7)+(2*6)+(1*6)=210
210 % 10 = 0
So 149997-66-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N2OS3.ClH/c1-2-16-11(13)7-8-17-18-10-5-3-9(4-6-10)12(14)15;/h3-6,13H,2,7-8H2,1H3,(H2,14,15);1H/b13-11-;
