1501-10-6 Usage
Uses
Used in Pharmaceutical Industry:
7H-Pyrrolo[2,3-d]pyrimidin-4-amine, 5-methyl(9CI) is used as an enzyme inhibitor for its ability to target specific enzymes involved in various biological processes. Its unique structure and properties make it a valuable compound for the development of new drugs to treat a range of diseases.
Additionally, it is used as a potential drug candidate for various diseases due to its potential therapeutic effects. 7H-Pyrrolo[2,3-d]pyrimidin-4-amine, 5-methyl(9CI)'s ability to modulate biological pathways and interact with specific targets makes it a promising candidate for further research and development in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 1501-10-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,0 and 1 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1501-10:
(6*1)+(5*5)+(4*0)+(3*1)+(2*1)+(1*0)=36
36 % 10 = 6
So 1501-10-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4/c1-4-2-9-7-5(4)6(8)10-3-11-7/h2-3H,1H3,(H3,8,9,10,11)
