1501-10-6 Usage
General Description
The chemical 7H-Pyrrolo[2,3-d]pyrimidin-4-amine, 5-methyl- (9CI) is a derivative of pyrrolopyrimidine, and is classified as a heterocyclic compound. It has a molecular formula of C8H9N5, and a molecular weight of 167.19 g/mol. This chemical compound is commonly used in the pharmaceutical industry for its potential biological activities, particularly as an inhibitor of certain enzymes and as a potential drug candidate for various diseases. Its structure and properties make it a promising candidate for further research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 1501-10-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,0 and 1 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1501-10:
(6*1)+(5*5)+(4*0)+(3*1)+(2*1)+(1*0)=36
36 % 10 = 6
So 1501-10-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4/c1-4-2-9-7-5(4)6(8)10-3-11-7/h2-3H,1H3,(H3,8,9,10,11)
