15013-71-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-3-methylbenzonitrile is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its presence in the molecular structure allows for the development of new drugs with specific therapeutic properties, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Chloro-3-methylbenzonitrile is utilized as a precursor in the production of pesticides and other agrochemicals. Its chemical properties make it suitable for the creation of effective and targeted pest control agents.
Used in Dye Industry:
2-CHLORO-3-METHYLBENZONITRILE is also employed as a building block in the synthesis of dyes, where its unique structure contributes to the development of dyes with specific color characteristics and properties, enhancing the range of colorants available for various applications.
Used in Organic Synthesis:
2-Chloro-3-methylbenzonitrile is a valuable component in organic synthesis, where it serves as a starting material for the preparation of various organic compounds. Its reactivity and functional groups make it a useful precursor in the synthesis of complex organic molecules.
It is crucial to handle 2-Chloro-3-methylbenzonitrile with care, as it is a hazardous substance that can cause irritation to the skin, eyes, and respiratory system upon contact or inhalation. Proper safety precautions are necessary during its handling and storage to prevent exposure and potential harm.
Check Digit Verification of cas no
The CAS Registry Mumber 15013-71-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,0,1 and 3 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 15013-71:
(7*1)+(6*5)+(5*0)+(4*1)+(3*3)+(2*7)+(1*1)=65
65 % 10 = 5
So 15013-71-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClN/c1-6-3-2-4-7(5-10)8(6)9/h2-4H,1H3
