150163-13-6 Usage
Description
3-Bromo-2-methylacrylonitrile is an organic compound that is known for its reactivity with various alkyl bromides. It is characterized by its ability to form allylated and vinylated products when reacted with alkyl bromides in the presence of bistributyltin. This unique property makes it a versatile building block in organic synthesis and a potential candidate for various applications in different industries.
Uses
Used in Chemical Synthesis:
3-Bromo-2-methylacrylonitrile is used as a key intermediate in the synthesis of various organic compounds. Its reactivity with alkyl bromides allows for the formation of a wide range of allylated and vinylated products, making it a valuable asset in the development of new chemical entities.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Bromo-2-methylacrylonitrile is used as a building block for the development of new drugs. Its ability to form diverse chemical structures makes it a promising candidate for the synthesis of novel therapeutic agents with potential applications in various medical conditions.
Used in Agrochemical Industry:
3-Bromo-2-methylacrylonitrile is also utilized in the agrochemical industry for the synthesis of new pesticides and other agrochemical products. Its versatility in forming different chemical structures allows for the development of innovative solutions to address various challenges in agriculture.
Used in Material Science:
In the field of material science, 3-Bromo-2-methylacrylonitrile is used as a component in the development of new materials with specific properties. Its reactivity with alkyl bromides can lead to the creation of materials with unique characteristics, such as improved strength, flexibility, or chemical resistance.
Used in Dye and Pigment Industry:
3-Bromo-2-methylacrylonitrile is employed in the dye and pigment industry for the synthesis of novel colorants. Its ability to form a variety of chemical structures enables the development of new dyes and pigments with enhanced properties, such as improved color strength, stability, and resistance to various environmental factors.
Check Digit Verification of cas no
The CAS Registry Mumber 150163-13-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,0,1,6 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 150163-13:
(8*1)+(7*5)+(6*0)+(5*1)+(4*6)+(3*3)+(2*1)+(1*3)=86
86 % 10 = 6
So 150163-13-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H4BrN/c1-4(2-5)3-6/h2H,1H3/b4-2+
