150444-95-4 Usage
Uses
Used in Pharmaceutical Synthesis:
3-Chloro-4,5-difluorobenzoic acid is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with improved therapeutic properties and reduced side effects.
Used in Agrochemical Production:
3-CHLORO-4,5-DIFLUOROBENZOIC ACID also finds application in the production of agrochemicals, where it serves as an essential building block for the creation of effective and environmentally friendly pesticides and other agricultural chemicals.
Used in Organic Synthesis as a Reagent:
3-Chloro-4,5-difluorobenzoic acid is employed as a reagent in organic synthesis, facilitating various chemical reactions and contributing to the synthesis of a wide range of organic compounds.
Used in the Production of Chemical Compounds:
As an intermediate, 3-Chloro-4,5-difluorobenzoic acid plays a crucial role in the production of various chemical compounds, including those used in the manufacture of dyes, plastics, and other industrial materials.
Check Digit Verification of cas no
The CAS Registry Mumber 150444-95-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,0,4,4 and 4 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 150444-95:
(8*1)+(7*5)+(6*0)+(5*4)+(4*4)+(3*4)+(2*9)+(1*5)=114
114 % 10 = 4
So 150444-95-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H3ClF2O2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,(H,11,12)
