150491-98-8 Usage
General Description
N-[5-(Diethylamino)-1-phenylpentyl]-4-nitrobenzamide hydrochloride is a chemical compound that belongs to the class of amides. It is often used in pharmaceutical research and development as a potential drug candidate due to its pharmacological properties. The compound is a hydrochloride salt form, which makes it more soluble in water and suitable for use in aqueous solutions. Its chemical structure includes a nitrobenzene group, a diethylamino group, and a phenylpentyl group, which collectively contribute to its biological activity and potential therapeutic effects. The compound's specific mechanism of action and potential medical applications may vary, depending on the context and intended use in research or drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 150491-98-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,0,4,9 and 1 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 150491-98:
(8*1)+(7*5)+(6*0)+(5*4)+(4*9)+(3*1)+(2*9)+(1*8)=128
128 % 10 = 8
So 150491-98-8 is a valid CAS Registry Number.
InChI:InChI=1/C22H29N3O3.ClH/c1-3-24(4-2)17-9-8-12-21(18-10-6-5-7-11-18)23-22(26)19-13-15-20(16-14-19)25(27)28;/h5-7,10-11,13-16,21H,3-4,8-9,12,17H2,1-2H3,(H,23,26);1H