150587-69-2 Usage
Uses
Used in Organic Synthesis:
TRANS-1-(1-ADAMANTYL)PROPENE is used as a reagent in organic synthesis for its ability to undergo addition reactions with various compounds, contributing to the formation of new chemical entities.
Used in Chemical Reactions:
TRANS-1-(1-ADAMANTYL)PROPENE is utilized in chemical reactions as an intermediate, facilitating the synthesis of more complex molecules and contributing to the advancement of chemical research and development.
Used in Polymer Production:
TRANS-1-(1-ADAMANTYL)PROPENE is used as a precursor in the production of polymers, where its reactive double bond allows for the formation of long-chain polymeric structures with specific properties.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, TRANS-1-(1-ADAMANTYL)PROPENE is used as a building block for the synthesis of various pharmaceutical compounds, potentially leading to the development of new drugs with unique therapeutic properties.
Used in Agrochemicals:
This chemical compound is also employed in the agrochemical industry, where it may be used in the synthesis of pesticides, herbicides, or other agricultural chemicals to improve crop protection and yield.
It is important to handle TRANS-1-(1-ADAMANTYL)PROPENE with caution due to its flammability and potential health hazards, ensuring safety measures are in place during its use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 150587-69-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,0,5,8 and 7 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 150587-69:
(8*1)+(7*5)+(6*0)+(5*5)+(4*8)+(3*7)+(2*6)+(1*9)=142
142 % 10 = 2
So 150587-69-2 is a valid CAS Registry Number.
InChI:InChI=1S/C13H20/c1-2-3-13-7-10-4-11(8-13)6-12(5-10)9-13/h2-3,10-12H,4-9H2,1H3/b3-2+
