1510-05-0 Usage
Uses
Used in Pharmaceutical Industry:
(2S)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanamide is used as a potential therapeutic agent for its anti-inflammatory and analgesic properties. The presence of the indole group indicates that it may have diverse effects on biological systems, making it a candidate for further research and development in the pharmaceutical field.
Used in Research and Development:
In the scientific community, (2S)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanamide serves as a subject for research to explore its biological activities and potential applications. Further studies are needed to understand its full range of effects and how it can be utilized in various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 1510-05-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,1 and 0 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1510-05:
(6*1)+(5*5)+(4*1)+(3*0)+(2*0)+(1*5)=40
40 % 10 = 0
So 1510-05-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H16N4O2/c14-6-12(18)17-11(13(15)19)5-8-7-16-10-4-2-1-3-9(8)10/h1-4,7,11,16H,5-6,14H2,(H2,15,19)(H,17,18)/t11-/m0/s1
