151250-94-1 Usage
General Description
4-(1-Admantyl)-6-amino-1,3,5-trazin-2-ol is a chemical compound with the molecular formula C12H18N4O. It is a triazine-based compound with an adamantyl substituent and an amino group. 4-(1-ADAMANTYL)-6-AMINO-1,3,5-TRAZIN-2-OL has potential applications in the pharmaceutical and agricultural industries due to its unique structural features. It may be used as a building block for the synthesis of various biologically active molecules or as a potential herbicide or pesticide due to its ability to inhibit specific enzymes or receptors. Further research is needed to fully understand the potential uses and effects of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 151250-94-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,1,2,5 and 0 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 151250-94:
(8*1)+(7*5)+(6*1)+(5*2)+(4*5)+(3*0)+(2*9)+(1*4)=101
101 % 10 = 1
So 151250-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H18N4O/c14-11-15-10(16-12(18)17-11)13-4-7-1-8(5-13)3-9(2-7)6-13/h7-9H,1-6H2,(H3,14,15,16,17,18)
