15128-50-4 Usage
Uses
Used in Organic Synthesis:
Dibenz[b,e]oxepine-6,11-dione is used as a key intermediate in organic synthesis for the production of various complex organic molecules. Its unique tricyclic structure and diketone functional group enable the formation of diverse chemical entities through various synthetic routes.
Used in Pharmaceutical Industry:
Dibenz[b,e]oxepine-6,11-dione is used as a building block for the synthesis of pharmaceuticals and biologically active compounds. Its structural features allow for the development of new drugs with potential therapeutic applications in various diseases.
Used in Antibacterial Applications:
Dibenz[b,e]oxepine-6,11-dione is used as an antibacterial agent due to its potential to inhibit bacterial growth. Its chemical properties allow it to target and disrupt essential cellular processes in bacteria, providing a means to combat bacterial infections.
Used in Antifungal Applications:
Dibenz[b,e]oxepine-6,11-dione is used as an antifungal agent, exhibiting the ability to inhibit fungal growth and prevent the development of fungal infections. Its chemical structure enables it to target specific fungal enzymes or pathways, making it a valuable asset in antifungal therapy.
Used in Cancer Treatment Research:
Dibenz[b,e]oxepine-6,11-dione is used as a proteasome inhibitor in cancer treatment research. The proteasome is a cellular protein degradation system that plays a crucial role in the survival and proliferation of cancer cells. Inhibition of the proteasome can lead to the accumulation of misfolded proteins, ultimately resulting in cell death. Dibenz[b,e]oxepine-6,11-dione has been investigated for its potential to target the proteasome and disrupt its function, offering a novel approach to cancer therapy.
Check Digit Verification of cas no
The CAS Registry Mumber 15128-50-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,1,2 and 8 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 15128-50:
(7*1)+(6*5)+(5*1)+(4*2)+(3*8)+(2*5)+(1*0)=84
84 % 10 = 4
So 15128-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H8O3/c15-13-9-5-1-2-6-10(9)14(16)17-12-8-4-3-7-11(12)13/h1-8H
