151412-02-1 Usage
Uses
Used in Pharmaceutical Synthesis:
2,3,6-Trifluorobenzyl bromide is utilized as a reactant in the synthesis of pharmaceuticals, where its ability to act as a halide source is crucial for various chemical reactions. It contributes to the development of new drugs by facilitating the formation of desired molecular structures.
Used in Agrochemical Production:
In the agrochemical industry, 2,3,6-Trifluorobenzyl bromide serves as a key reactant in the creation of compounds used in crop protection and other agricultural applications. Its reactivity allows for the synthesis of molecules with specific properties that can be tailored for use in pesticides or other agrochemical products.
Used in Organic Chemistry Research:
As a reagent in organic chemistry, 2,3,6-Trifluorobenzyl bromide is employed in academic and industrial research settings. Its unique properties make it suitable for exploring new reaction pathways and developing innovative synthetic methods.
Safety Considerations:
Given the potential hazards associated with 2,3,6-Trifluorobenzyl bromide, it is imperative to handle this chemical with care and implement proper safety procedures during its use. This includes the use of personal protective equipment, working in well-ventilated areas, and adhering to established laboratory safety guidelines to minimize risks.
Check Digit Verification of cas no
The CAS Registry Mumber 151412-02-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,1,4,1 and 2 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 151412-02:
(8*1)+(7*5)+(6*1)+(5*4)+(4*1)+(3*2)+(2*0)+(1*2)=81
81 % 10 = 1
So 151412-02-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3
