1515-23-7 Usage
Uses
Used in Pharmaceutical Industry:
2,5-Cyclohexadiene-1,2-dicarboxylic acid is used as a key intermediate for the synthesis of various drugs, particularly for the treatment of cancer and other diseases. Its unique structure allows for the development of new and effective pharmaceutical compounds.
Used in Materials Science:
2,5-Cyclohexadiene-1,2-dicarboxylic acid has potential applications in the field of materials science, where it can be used to create new materials with specific properties.
Used as a Precursor in Organic Synthesis:
2,5-Cyclohexadiene-1,2-dicarboxylic acid is used as a precursor for the synthesis of various bioactive compounds, contributing to the development of new chemical entities with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1515-23-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,1 and 5 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1515-23:
(6*1)+(5*5)+(4*1)+(3*5)+(2*2)+(1*3)=57
57 % 10 = 7
So 1515-23-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1,3-5H,2H2,(H,9,10)(H,11,12)
