151539-49-0 Usage
Description
(2E)-3-(3-BROMO-4-METHOXYPHENYL)ACRYLIC ACID is a chemical compound with the molecular formula C10H9BrO3. It is a derivative of acrylic acid and contains a bromine atom and a methoxy group on the phenyl ring. (2E)-3-(3-BROMO-4-METHOXYPHENYL)ACRYLIC ACID is commonly used as a building block in organic synthesis and pharmaceutical research. It is also known to have potential biological activities, making it a valuable tool for drug discovery and development. Additionally, (2E)-3-(3-Bromo-4-methoxyphenyl)acrylic acid may have applications in materials science and catalysis due to its unique chemical structure and reactivity.
Uses
Used in Pharmaceutical Research:
(2E)-3-(3-BROMO-4-METHOXYPHENYL)ACRYLIC ACID is used as a building block in pharmaceutical research for the development of new drugs. Its unique chemical structure and reactivity make it a valuable tool for drug discovery and development.
Used in Organic Synthesis:
(2E)-3-(3-BROMO-4-METHOXYPHENYL)ACRYLIC ACID is used as a building block in organic synthesis for the creation of various chemical compounds. Its bromine atom and methoxy group on the phenyl ring provide unique properties that can be utilized in the synthesis process.
Used in Materials Science:
(2E)-3-(3-BROMO-4-METHOXYPHENYL)ACRYLIC ACID may have applications in materials science due to its unique chemical structure and reactivity. It could potentially be used in the development of new materials with specific properties.
Used in Catalysis:
(2E)-3-(3-BROMO-4-METHOXYPHENYL)ACRYLIC ACID may also have applications in catalysis due to its unique chemical structure and reactivity. It could potentially be used as a catalyst or in the development of new catalytic processes.
Check Digit Verification of cas no
The CAS Registry Mumber 151539-49-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,1,5,3 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 151539-49:
(8*1)+(7*5)+(6*1)+(5*5)+(4*3)+(3*9)+(2*4)+(1*9)=130
130 % 10 = 0
So 151539-49-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BrO3/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6H,1H3,(H,12,13)/b5-3+