151539-60-5 Usage
General Description
"(E)-8-(2-(1,4-Benzodioxan-6-yl)vinyl)-7-methyl-1,3-dipropylxanthine" is a chemical compound with a complex structure that includes a xanthine core, a (E)-8-(2-(1,4-Benzodioxan-6-yl)vinyl) side chain, and two propyl groups. Xanthine is a purine base found in certain body tissues and fluids, and it is a precursor in the formation of uric acid. The (E)-8-(2-(1,4-Benzodioxan-6-yl)vinyl) side chain contains a benzodioxane ring, which is a structural motif found in various natural products and pharmaceuticals. The presence of a methyl group and two propyl groups further contributes to the complexity of this compound. The specific properties and potential uses of "(E)-8-(2-(1,4-Benzodioxan-6-yl)vinyl)-7-methyl-1,3-dipropylxanthine" would depend on its interactions with biological systems and its potential applications in drug development or other scientific research.
Check Digit Verification of cas no
The CAS Registry Mumber 151539-60-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,1,5,3 and 9 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 151539-60:
(8*1)+(7*5)+(6*1)+(5*5)+(4*3)+(3*9)+(2*6)+(1*0)=125
125 % 10 = 5
So 151539-60-5 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N4O4/c1-4-10-25-20-19(21(27)26(11-5-2)22(25)28)24(3)18(23-20)9-7-15-6-8-16-17(14-15)30-13-12-29-16/h6-9,14H,4-5,10-13H2,1-3H3/b9-7+