15182-68-0 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole is utilized as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its unique structure allows it to be incorporated into the development of new drugs and pesticides, potentially enhancing their efficacy and selectivity.
Used in Propellant and Explosive Industries:
As a stabilizer, 1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole is employed in propellants and explosives to improve their stability and performance. Its presence can help to prevent the degradation of these materials over time, ensuring their reliability and safety.
Used in Material Science:
1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole has potential applications in the development of new materials. Its unique properties can be leveraged to create innovative materials with specific characteristics, such as improved mechanical strength, thermal stability, or chemical resistance.
Used in Academic Research:
In the realm of academic research, 1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole serves as a valuable compound for exploring new chemical reactions, synthesis pathways, and the study of its physical and chemical properties. This research can lead to a deeper understanding of its potential applications and the discovery of new uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 15182-68-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,1,8 and 2 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 15182-68:
(7*1)+(6*5)+(5*1)+(4*8)+(3*2)+(2*6)+(1*8)=100
100 % 10 = 0
So 15182-68-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N4OS/c1-2-14-8-5-3-7(4-6-8)13-9(15)10-11-12-13/h3-6H,2H2,1H3,(H,10,12,15)
