15182-68-0 Usage
General Description
1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole is a chemical compound with the chemical formula C9H10N4OS. It is a tetrazole derivative with a thiol group and an ethoxyphenyl moiety. 1-(4-ETHOXYPHENYL)-5-MERCAPTO-1H-TETRAZOLE has various applications, including its use as an intermediate in the synthesis of pharmaceuticals and agrochemicals. It is also used as a stabilizer in propellants and explosives. Additionally, 1-(4-Ethoxyphenyl)-5-mercapto-1H-tetrazole has potential applications in the development of new materials and in academic research. Its unique structure and properties make it a valuable building block for the synthesis of complex molecules and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 15182-68-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,1,8 and 2 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 15182-68:
(7*1)+(6*5)+(5*1)+(4*8)+(3*2)+(2*6)+(1*8)=100
100 % 10 = 0
So 15182-68-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N4OS/c1-2-14-8-5-3-7(4-6-8)13-9(15)10-11-12-13/h3-6H,2H2,1H3,(H,10,12,15)
