15191-21-6 Usage
General Description
N-Formyl-L-histidine is a chemical compound most commonly associated with biochemical research. This organic compound, classified as a peptide, consists primarily of the amino acid histidine. It is distinctive due to the presence of a formyl group, which makes it an important component in protein synthesis. Its involvement in these biological processes makes N-Formyl-L-histidine crucial in numerous chemical reactions throughout the body. Further, it plays a significant role in scientific research, particularly in the development of medications and the understanding of various biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 15191-21-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,1,9 and 1 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 15191-21:
(7*1)+(6*5)+(5*1)+(4*9)+(3*1)+(2*2)+(1*1)=86
86 % 10 = 6
So 15191-21-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O3/c11-4-10-6(7(12)13)1-5-2-8-3-9-5/h2-4,6H,1H2,(H,8,9)(H,10,11)(H,12,13)/t6-/m0/s1
