15193-51-8 Usage
General Description
5-methoxy-3H-benzothiazol-2-one is a chemical compound with the molecular formula C9H7NOS. It is a benzothiazole derivative with a methoxy group attached to the carbon atom at the 5-position. 5-methoxy-3H-benzothiazol-2-one is commonly used in organic synthesis and pharmaceutical research due to its versatile reactivity and potential pharmacological properties. It has been studied for its potential as an anti-inflammatory, antioxidant, and neuroprotective agent. Additionally, 5-methoxy-3H-benzothiazol-2-one has also been evaluated for its potential as a fluorescent probe for the detection of metal ions. Overall, this compound exhibits a range of chemical and biological properties that make it a valuable tool for various applications in research and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 15193-51-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,1,9 and 3 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 15193-51:
(7*1)+(6*5)+(5*1)+(4*9)+(3*3)+(2*5)+(1*1)=98
98 % 10 = 8
So 15193-51-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H7NO2S/c1-11-5-2-3-7-6(4-5)9-8(10)12-7/h2-4H,1H3,(H,9,10)
