1520-96-3 Usage
Description
PERYLENE-D12 is a deuterium-labelled variant of Perylene, a molecule known for its unique properties and applications in various fields. It is characterized by its stable structure and distinctive fluorescent properties, making it a valuable compound for research and industrial purposes.
Uses
Used in Photochemistry and Optoelectronics:
PERYLENE-D12 is used as an acceptor for pristine C70, functioning as a sensitizer for efficient triplet-triplet annihilation upconversion. This application takes advantage of its improved stability under continuous laser irradiation compared to the benchmark Pt(II)-octaethylprphyrin, making it a promising candidate for photochemical and optoelectronic applications.
Used in Fluorescent Dye Applications:
PERYLENE-D12 is utilized as a dopant representing a blue fluorescent dye on a white-emitting polymer film. Its distinctive fluorescent properties contribute to the development of advanced materials with enhanced optical characteristics.
Used in Analytical Chemistry:
PERYLENE-D12 may be employed as an analytical standard due to its stable and well-defined chemical properties. This makes it a valuable tool for calibration and quality control in various analytical techniques and experiments.
Check Digit Verification of cas no
The CAS Registry Mumber 1520-96-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,2 and 0 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1520-96:
(6*1)+(5*5)+(4*2)+(3*0)+(2*9)+(1*6)=63
63 % 10 = 3
So 1520-96-3 is a valid CAS Registry Number.
InChI:InChI=1/C20H12/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D