152126-33-5 Usage
Uses
Used in Pharmaceutical Industry:
4-Fluoronicotinic acid is used as a building block for the synthesis of various drugs. Its unique structure and reactivity make it a valuable component in the development of new pharmaceuticals with improved efficacy and selectivity.
Used in Agrochemical Industry:
4-Fluoronicotinic acid is utilized in the synthesis of agrochemicals, contributing to the development of more effective and targeted pesticides and other agricultural chemicals.
Used in Organic Synthesis:
As a reagent in organic synthesis, 4-Fluoronicotinic acid is employed to facilitate various chemical reactions, enabling the formation of complex organic compounds with potential applications in various fields.
Used in the Production of Fluoropyridines:
4-Fluoronicotinic acid serves as an important intermediate in the production of fluoropyridines, which are key components in the synthesis of a wide range of pharmaceuticals. The incorporation of fluorine into the pyridine ring can significantly influence the pharmacokinetic and pharmacodynamic properties of the resulting drugs, leading to improved therapeutic outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 152126-33-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,2,1,2 and 6 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 152126-33:
(8*1)+(7*5)+(6*2)+(5*1)+(4*2)+(3*6)+(2*3)+(1*3)=95
95 % 10 = 5
So 152126-33-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H4FNO2/c7-5-1-2-8-3-4(5)6(9)10/h1-3H,(H,9,10)
